
CAS 1249544-27-1
:2-Chloro-6-fluoro-α-(trifluoromethyl)benzenemethanol
Description:
2-Chloro-6-fluoro-α-(trifluoromethyl)benzenemethanol, identified by its CAS number 1249544-27-1, is a chemical compound that features a complex aromatic structure. This substance contains a benzene ring substituted with a chlorine atom at the 2-position, a fluorine atom at the 6-position, and a trifluoromethyl group at the alpha position relative to the benzenemethanol moiety. The presence of these halogen substituents contributes to its unique chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The hydroxymethyl group (-CH2OH) indicates that it can participate in hydrogen bonding, influencing its solubility and interaction with biological systems. Additionally, the trifluoromethyl group is known for enhancing lipophilicity and metabolic stability. Overall, this compound's characteristics make it of interest for further research and development in synthetic chemistry and material science.
Formula:C8H5ClF4O
InChI:InChI=1S/C8H5ClF4O/c9-4-2-1-3-5(10)6(4)7(14)8(11,12)13/h1-3,7,14H
InChI key:InChIKey=HAFNMYQVKGJDSZ-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(O)C1=C(Cl)C=CC=C1F
Synonyms:- 2-Chloro-6-fluoro-α-(trifluoromethyl)benzenemethanol
- Benzenemethanol, 2-chloro-6-fluoro-α-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.