CAS 1249547-97-4

3-Chloro-N-cyclobutyl-2-methylbenzenamine

Description:

3-Chloro-N-cyclobutyl-2-methylbenzenamine is an organic compound characterized by its aromatic amine structure, which includes a chlorinated benzene ring and a cyclobutyl substituent. The presence of the chlorine atom at the meta position relative to the amine group influences its reactivity and solubility properties. The cyclobutyl group contributes to the compound's three-dimensional structure, potentially affecting its steric hindrance and interaction with biological targets. This compound may exhibit properties typical of amines, such as basicity and nucleophilicity, making it relevant in various chemical reactions, including substitution and coupling reactions. Additionally, the presence of both the chlorine and the cyclobutyl group can impart unique characteristics, such as altered lipophilicity and potential biological activity. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Overall, 3-Chloro-N-cyclobutyl-2-methylbenzenamine is of interest in fields such as medicinal chemistry and materials science, where its unique structure may lead to novel applications.

Formula: C₁₁H₁₄ClN

InChI: InChI=1S/C11H14ClN/c1-8-10(12)6-3-7-11(8)13-9-4-2-5-9/h3,6-7,9,13H,2,4-5H2,1H3

InChI key: InChIKey=ATLHEEZPWIMGQN-UHFFFAOYSA-N

SMILES: N(C1=C(C)C(Cl)=CC=C1)C2CCC2

Synonyms:

• 3-Chloro-N-cyclobutyl-2-methylbenzenamine
• Benzenamine, 3-chloro-N-cyclobutyl-2-methyl-