CAS 1249549-42-5
:6-(5-Bromo-2-furanyl)-2-cyclopropyl-4-pyrimidinamine
Description:
6-(5-Bromo-2-furanyl)-2-cyclopropyl-4-pyrimidinamine is a chemical compound characterized by its unique structural features, which include a pyrimidine ring, a cyclopropyl group, and a brominated furan moiety. The presence of the bromine atom enhances its reactivity and may influence its biological activity. This compound is likely to exhibit properties typical of heterocyclic amines, such as potential solubility in organic solvents and varying degrees of polarity, depending on the substituents. The cyclopropyl group can impart strain and may affect the compound's conformation and reactivity. Additionally, the furan ring contributes to the compound's aromatic character, which can be significant in interactions with biological targets. Such compounds are often investigated for their pharmacological properties, including potential applications in medicinal chemistry. Overall, the combination of these structural elements suggests that 6-(5-Bromo-2-furanyl)-2-cyclopropyl-4-pyrimidinamine may possess interesting chemical and biological properties worthy of further study.
Formula:C11H10BrN3O
InChI:InChI=1S/C11H10BrN3O/c12-9-4-3-8(16-9)7-5-10(13)15-11(14-7)6-1-2-6/h3-6H,1-2H2,(H2,13,14,15)
InChI key:InChIKey=VOTIRXSHWPCGQA-UHFFFAOYSA-N
SMILES:NC1=CC(=NC(=N1)C2CC2)C3=CC=C(Br)O3
Synonyms:- 6-(5-Bromo-2-furanyl)-2-cyclopropyl-4-pyrimidinamine
- 4-Pyrimidinamine, 6-(5-bromo-2-furanyl)-2-cyclopropyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.