CAS 124962-06-7

Abrusoside A

Description:

Abrusoside A is a glycoside compound derived from the plant Abrus precatorius, commonly known as the rosary pea. It is characterized by its complex structure, which includes a sugar moiety linked to an aglycone, contributing to its biological activity. This compound is known for its potential pharmacological properties, including anti-inflammatory and analgesic effects, making it of interest in medicinal chemistry. Abrusoside A exhibits solubility in polar solvents, which is typical for glycosides, and its stability can be influenced by factors such as pH and temperature. Additionally, it may interact with various biological targets, leading to a range of physiological effects. However, caution is warranted due to the toxicity associated with other components of the Abrus plant, particularly abrin, which can pose health risks. Research continues to explore the therapeutic potential and safety profile of Abrusoside A, highlighting the importance of understanding the pharmacokinetics and mechanisms of action of such compounds in drug development.

Formula: C₃₆H₅₄O₁₀

InChI: InChI=1S/C36H54O10/c1-18-6-7-21(44-29(18)41)19(2)20-10-12-33(4)23-8-9-24-34(5,31(42)43)25(46-30-28(40)27(39)26(38)22(16-37)45-30)11-13-35(24)17-36(23,35)15-14-32(20,33)3/h6,19-28,30,37-40H,7-17H2,1-5H3,(H,42,43)/t19-,20+,21-,22+,23-,24-,25-,26+,27-,28+,30-,32+,33-,34-,35+,36-/m0/s1

InChI key: InChIKey=CJHYXUPCGHKJOO-AYOTXDKCSA-N

SMILES: C[C@]12[C@]3([C@]4([C@]5(C4)[C@]([C@@](C(O)=O)(C)[C@@H](O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)CC5)(CC3)[H])CC[C@]1(C)[C@@]([C@H](C)[C@]7(OC(=O)C(C)=CC7)[H])(CC2)[H])[H]

Synonyms:

• Abrusoside A
• 9,19-Cyclolanost-24-ene-26,28-dioic acid, 3-(β-D-glucopyranosyloxy)-22-hydroxy-, δ-lactone, (3β,4α,22S)-
• (+)-Abrusoside A

Abrusoside A

CAS: 124962-06-7

Abrusoside A is a triterpenoid saponin found in Abrus precatorius that can be used as a sweetener.

Formula: C₃₆H₅₄O₁₀

Color and Shape: Solid

Molecular weight: 646.81

Ref: TM-T71134