
CAS 1249769-71-8
:Thiomorpholine, 4-[(2-chloro-3-pyridinyl)methyl]-, 1,1-dioxide
Description:
Thiomorpholine, 4-[(2-chloro-3-pyridinyl)methyl]-, 1,1-dioxide is a chemical compound characterized by its unique structure, which includes a thiomorpholine ring and a chlorinated pyridine moiety. The presence of the 1,1-dioxide functional group indicates that it has two oxygen atoms double-bonded to the sulfur atom in the thiomorpholine ring, enhancing its reactivity and potential biological activity. This compound is typically classified as a heterocyclic organic compound due to the incorporation of nitrogen and sulfur in its ring structure. It may exhibit properties such as solubility in polar solvents and potential interactions with biological targets, making it of interest in pharmaceutical research. The chlorinated pyridine substituent can influence its pharmacokinetic properties, including absorption and metabolism. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific safety and handling guidelines should be followed due to the presence of chlorine and the potential for biological activity.
Formula:C10H13ClN2O2S
InChI:InChI=1S/C10H13ClN2O2S/c11-10-9(2-1-3-12-10)8-13-4-6-16(14,15)7-5-13/h1-3H,4-8H2
InChI key:InChIKey=OJRREINROVPQQC-UHFFFAOYSA-N
SMILES:C(N1CCS(=O)(=O)CC1)C2=C(Cl)N=CC=C2
Synonyms:- Thiomorpholine, 4-[(2-chloro-3-pyridinyl)methyl]-, 1,1-dioxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.