
CAS 1249784-86-8
:N-Bicyclo[2.2.1]hept-2-yl-2-thiopheneethanamine
Description:
N-Bicyclo[2.2.1]hept-2-yl-2-thiopheneethanamine is a chemical compound characterized by its bicyclic structure, which includes a bicyclo[2.2.1]heptane framework fused with a thiophene ring. This compound features an amine functional group, which contributes to its potential reactivity and biological activity. The presence of the thiophene moiety may impart unique electronic properties, making it of interest in various fields, including medicinal chemistry and materials science. The bicyclic structure can influence the compound's steric and electronic properties, potentially affecting its interactions with biological targets. Additionally, the compound's specific stereochemistry and substituents can play a crucial role in determining its pharmacological profile. As with many amines, it may exhibit basicity and can participate in hydrogen bonding, which can affect its solubility and reactivity in different environments. Overall, N-Bicyclo[2.2.1]hept-2-yl-2-thiopheneethanamine presents a unique combination of structural features that may be explored for various applications in research and industry.
Formula:C13H19NS
InChI:InChI=1S/C13H19NS/c1-2-12(15-7-1)5-6-14-13-9-10-3-4-11(13)8-10/h1-2,7,10-11,13-14H,3-6,8-9H2
InChI key:InChIKey=ZFUNWHBUBZPXFS-UHFFFAOYSA-N
SMILES:N(CCC1=CC=CS1)C2C3CC(C2)CC3
Synonyms:- N-Bicyclo[2.2.1]hept-2-yl-2-thiopheneethanamine
- 2-Thiopheneethanamine, N-bicyclo[2.2.1]hept-2-yl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.