CAS 1249845-38-2
:3-(1,1-Dimethylethyl)-1H-pyrazole-4-sulfonyl chloride
Description:
3-(1,1-Dimethylethyl)-1H-pyrazole-4-sulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and ability to form sulfonamides. This compound features a pyrazole ring, a five-membered aromatic heterocycle containing two nitrogen atoms, contributing to its unique chemical properties. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its steric bulk, which can influence its reactivity and interactions with other molecules. As a sulfonyl chloride, it is typically used as a reagent in organic synthesis, particularly for the introduction of sulfonyl groups into various substrates. The compound is likely to be sensitive to moisture and should be handled under anhydrous conditions to prevent hydrolysis. Its applications may extend to pharmaceuticals and agrochemicals, where sulfonyl groups play a crucial role in biological activity. Safety precautions are essential when working with this compound due to its potential irritant properties and reactivity with nucleophiles.
Formula:C7H11ClN2O2S
InChI:InChI=1S/C7H11ClN2O2S/c1-7(2,3)6-5(4-9-10-6)13(8,11)12/h4H,1-3H3,(H,9,10)
InChI key:InChIKey=ABOMRAOEHFYMJG-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C=1C(S(Cl)(=O)=O)=CNN1
Synonyms:- 3-(1,1-Dimethylethyl)-1H-pyrazole-4-sulfonyl chloride
- 1H-Pyrazole-4-sulfonyl chloride, 3-(1,1-dimethylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.