CAS 124998-64-7
:diphenyl-[2-[4,6,8-tris(2-diphenylphosphanylethyl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]ethyl]phosphane
Description:
Diphenyl-[2-[4,6,8-tris(2-diphenylphosphanylethyl)-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]ethyl]phosphane, with CAS number 124998-64-7, is a complex organophosphorus compound characterized by its intricate molecular structure, which includes multiple phosphane groups and a siloxane backbone. This compound typically exhibits properties associated with organophosphorus chemistry, such as potential applications in catalysis, materials science, and as ligands in coordination chemistry. The presence of multiple diphenylphosphanylethyl groups suggests enhanced stability and solubility in organic solvents, while the siloxane component may contribute to flexibility and thermal stability. Additionally, the compound's unique structure may impart interesting electronic properties, making it a candidate for research in areas like organic electronics or photonics. Its synthesis and reactivity are likely influenced by the steric and electronic effects of the bulky diphenyl groups, which can affect coordination with metal centers in catalytic applications. Overall, this compound represents a fascinating intersection of organophosphorus and siloxane chemistry.
Formula:C60H68O4P4Si4
InChI:InChI=1/C60H68O4P4Si4/c1-69(49-45-65(53-29-13-5-14-30-53)54-31-15-6-16-32-54)61-70(2,50-46-66(55-33-17-7-18-34-55)56-35-19-8-20-36-56)63-72(4,52-48-68(59-41-25-11-26-42-59)60-43-27-12-28-44-60)64-71(3,62-69)51-47-67(57-37-21-9-22-38-57)58-39-23-10-24-40-58/h5-44H,45-52H2,1-4H3
SMILES:C[Si]1(CCP(c2ccccc2)c2ccccc2)O[Si](C)(CCP(c2ccccc2)c2ccccc2)O[Si](C)(CCP(c2ccccc2)c2ccccc2)O[Si](C)(CCP(c2ccccc2)c2ccccc2)O1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Phosphine, 1,1',1'',1'''-[(2,4,6,8-tetramethylcyclotetrasiloxane-2,4,6,8-tetrayl)tetra-2,1-ethanediyl]tetrakis[1,1-diphenyl-
CAS:Formula:C60H68O4P4Si4Molecular weight:1089.4166
