CAS 125-23-5
:N-methylmorphinium bromide
Description:
N-methylmorphinium bromide is a quaternary ammonium salt characterized by its structure, which includes a morpholine ring with a methyl group attached to the nitrogen atom. This compound typically appears as a white crystalline solid and is soluble in water and various organic solvents, making it useful in diverse applications. Its ionic nature contributes to its properties, including its ability to act as a surfactant and its potential use in biological systems. N-methylmorphinium bromide can exhibit antimicrobial activity, which has led to its exploration in pharmaceutical and agricultural contexts. Additionally, it may serve as a phase transfer catalyst in organic synthesis, facilitating the transfer of reactants between different phases. Safety considerations are important, as with many quaternary ammonium compounds, due to potential toxicity and environmental impact. Proper handling and disposal protocols should be followed to mitigate risks associated with its use. Overall, N-methylmorphinium bromide is a versatile compound with significant relevance in both industrial and research settings.
Formula:C18H22BrNO3
InChI:InChI=1/C18H21NO3.BrH/c1-19(2)8-7-18-11-4-6-14(21)17(18)22-16-13(20)5-3-10(15(16)18)9-12(11)19;/h3-6,11-12,14,17,21H,7-9H2,1-2H3;1H/t11-,12+,14-,17-,18-;/m0./s1
InChI key:InChIKey=KQUQZJSQMSHWHP-SCLAZZCHSA-N
SMILES:O[C@@H]1[C@]2([C@]34C=5C(O2)=C(O)C=CC5C[C@]([C@@]3(C=C1)[H])([N+](C)(C)CC4)[H])[H].[Br-]
Synonyms:- (5Alpha,6Alpha)-17,17-Dimethyl-7,8-Didehydro-4,5-Epoxymorphinan-17-Ium-3,6-Diol Bromide
- Morphinanium, 7,8-didehydro-4,5-epoxy-3,6-dihydroxy-17,17-dimethyl-, bromide (1:1), (5α,6α)-
- Morphinanium, 7,8-didehydro-4,5-epoxy-3,6-dihydroxy-17,17-dimethyl-, bromide, (5α,6α)-
- Morphinanium, 7,8-didehydro-4,5α-epoxy-3,6α-dihydroxy-17,17-dimethyl-, bromide
- Morphine Methobromide
- Morphine methylbromide
- Morphosan
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Morphosan
CAS:Controlled ProductMorphosan is a potent anticancer drug that is an analog of heparin. It has been shown to inhibit the growth of cancer cells in both human and Chinese hamster ovary cell lines. Morphosan acts as an inhibitor of chitin synthesis, which is essential for the growth and development of tumor cells. Additionally, it inhibits tumor kinase activity, leading to apoptosis (cell death) in cancer cells. Morphosan has also been found in urine samples from patients with cancer, suggesting its potential as a biomarker for the disease. Its potassium salt form has been shown to have higher solubility and better pharmacokinetic properties than its free acid form. Overall, Morphosan shows great promise as a potential therapeutic agent for cancer treatment.Formula:C18H22NO3•BrPurity:Min. 95%Molecular weight:380.3 g/mol

