CAS 125-55-3
:5-(2-Bromo-2-propen-1-yl)-1-methyl-5-(1-methylethyl)-2,4,6(1H,3H,5H)-pyrimidinetrione
Description:
The chemical substance known as 5-(2-Bromo-2-propen-1-yl)-1-methyl-5-(1-methylethyl)-2,4,6(1H,3H,5H)-pyrimidinetrione, with the CAS number 125-55-3, is a pyrimidine derivative characterized by its complex structure that includes a pyrimidinetrione core and various substituents. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in organic solvents. The presence of the bromoalkene group suggests it may participate in electrophilic addition reactions, while the pyrimidinetrione moiety indicates potential biological activity, possibly as a pharmaceutical agent or a biochemical probe. Its molecular structure may confer specific reactivity patterns, making it of interest in synthetic organic chemistry and medicinal chemistry. Additionally, the compound's stability, reactivity, and potential applications can be influenced by the steric and electronic effects of the substituents attached to the pyrimidine ring. Overall, this compound represents a unique class of organic molecules with potential utility in various chemical and biological contexts.
Formula:C11H15BrN2O3
InChI:InChI=1S/C11H15BrN2O3/c1-6(2)11(5-7(3)12)8(15)13-10(17)14(4)9(11)16/h6H,3,5H2,1-2,4H3,(H,13,15,17)
InChI key:InChIKey=WGMASVSHOSNKMF-UHFFFAOYSA-N
SMILES:C(C(Br)=C)C1(C(C)C)C(=O)N(C)C(=O)NC1=O
Synonyms:- 1-Methyl-5-isopropyl-5-(2-bromoallyl)barbituric acid
- 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-(2-bromo-2-propen-1-yl)-1-methyl-5-(1-methylethyl)-
- 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-(2-bromo-2-propenyl)-1-methyl-5-(1-methylethyl)-
- 5-(2-Bromo-2-propen-1-yl)-1-methyl-5-(1-methylethyl)-2,4,6(1H,3H,5H)-pyrimidinetrione
- 5-(2-Bromoallyl)-1-methyl-5-isopropylbarbituric acid
- 5-(2-Bromoallyl)-5-isopropyl-1-methylbarbituric acid
- 5-(2-bromoprop-2-en-1-yl)-1-methyl-5-(propan-2-yl)pyrimidine-2,4,6(1H,3H,5H)-trione
- 5-(2′-Bromallyl)-5-isopropyl-1-methylbarbituric acid
- Barbituric acid, 5-(2-bromoallyl)-5-isopropyl-1-methyl-
- Enibomal
- Narcobarbital
- Narcodorm
- Narcovene
- Narcovene S
- Narkotal
- Pronarcon
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Narcobarbital
CAS:Controlled ProductNarcobarbital is a barbiturate that is used to treat chronic pain and as an animal tranquilizer. It is also used in the treatment of infectious diseases, autoimmune diseases, and inflammatory diseases. Narcobarbital is a substrate for fatty acid synthase, which synthesizes fatty acids from acetyl-CoA and NADPH. The polymeric matrix of narcobarbital contains flunitrazepam, which has been shown to inhibit the synthesis of prostaglandins and leukotrienes. This drug has been shown to be effective against methicillin-resistant Staphylococcus aureus (MRSA) and Clostridium perfringens in clinical studies. Narcobarbital may be useful as an antimicrobial agent due to its ability to suppress the growth of bacteria by inhibiting protein synthesis.Formula:C11H15BrN2O3Purity:Min. 95%Molecular weight:303.15 g/mol
