CymitQuimica logo

CAS 1250050-26-0

:

1-[(4-Bromo-2-thienyl)methyl]-3-pyrrolidinemethanol

Description:
1-[(4-Bromo-2-thienyl)methyl]-3-pyrrolidinemethanol is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a thienyl group. The presence of the bromine atom on the thienyl ring contributes to its reactivity and potential biological activity. This compound features a hydroxymethyl group, which can participate in hydrogen bonding, influencing its solubility and interaction with biological targets. The molecular structure suggests that it may exhibit properties relevant to medicinal chemistry, potentially acting as a ligand or modulator in various biochemical pathways. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Additionally, the compound's safety profile and toxicity would need to be evaluated through experimental studies. Overall, 1-[(4-Bromo-2-thienyl)methyl]-3-pyrrolidinemethanol represents a compound of interest for further research in pharmacology and organic synthesis.
Formula:C10H14BrNOS
InChI:InChI=1S/C10H14BrNOS/c11-9-3-10(14-7-9)5-12-2-1-8(4-12)6-13/h3,7-8,13H,1-2,4-6H2
InChI key:InChIKey=YOWQMSRNOZQANZ-UHFFFAOYSA-N
SMILES:C(N1CC(CO)CC1)C=2SC=C(Br)C2
Synonyms:
  • 1-[(4-Bromo-2-thienyl)methyl]-3-pyrrolidinemethanol
  • 3-Pyrrolidinemethanol, 1-[(4-bromo-2-thienyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.