CAS 125008-83-5
:(Z)-4-[2-[2-[2-[[(Z)-4-hydroxy-4-oxo-but-2-enoyl]amino]ethoxy]ethoxy]ethylamino]-4-oxo-but-2-enoic acid
Description:
The chemical substance known as (Z)-4-[2-[2-[2-[[(Z)-4-hydroxy-4-oxo-but-2-enoyl]amino]ethoxy]ethoxy]ethylamino]-4-oxo-but-2-enoic acid, with the CAS number 125008-83-5, is a complex organic compound characterized by its multi-functional groups and structural features. It contains both amino and hydroxy functional groups, which contribute to its potential biological activity. The presence of the (Z)-configuration indicates specific stereochemistry, which can influence the compound's reactivity and interaction with biological targets. The compound is likely to exhibit properties typical of amino acids or peptide-like structures, including solubility in polar solvents and potential for forming hydrogen bonds. Its structural components suggest it may be involved in biochemical pathways or serve as a precursor for more complex molecules. The presence of the enoyl moiety indicates potential reactivity in various chemical reactions, including those involving nucleophiles. Overall, this compound's unique structure positions it as a candidate for further research in medicinal chemistry or related fields.
Formula:C14H20N2O8
InChI:InChI=1/C14H20N2O8/c17-11(1-3-13(19)20)15-5-7-23-9-10-24-8-6-16-12(18)2-4-14(21)22/h1-4H,5-10H2,(H,15,17)(H,16,18)(H,19,20)(H,21,22)/b3-1-,4-2-
SMILES:C(=C\C(=O)O)\C(=NCCOCCOCCN=C(/C=C\C(=O)O)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1,8-(Bismaleamic Acid)triethyleneglycol
CAS:Formula:C14H20N2O8Color and Shape:SolidMolecular weight:344.31721,8-(Bismaleamic Acid)triethyleneglycol
CAS:Controlled ProductFormula:C14H20N2O8Color and Shape:NeatMolecular weight:344.32

