CAS 125010-17-5
:lignarenone B
Description:
Lignarenone B, with the CAS number 125010-17-5, is a naturally occurring compound classified as a lignan, which is a type of polyphenolic compound found in various plants. Lignans are known for their antioxidant properties and potential health benefits, including anti-inflammatory and anticancer effects. Lignarenone B is characterized by its complex molecular structure, which typically includes multiple aromatic rings and hydroxyl groups that contribute to its biological activity. This compound is often studied for its role in plant defense mechanisms and its potential applications in pharmaceuticals and nutraceuticals. Its solubility, stability, and reactivity can vary depending on environmental conditions and the presence of other substances. Research into lignarenone B continues to explore its mechanisms of action and potential therapeutic uses, particularly in the context of chronic diseases and oxidative stress. As with many natural products, the extraction and purification processes are crucial for obtaining lignarenone B in a form suitable for scientific study and application.
Formula:C15H16O
InChI:InChI=1/C15H16O/c1-13(14(2)16)9-5-3-6-10-15-11-7-4-8-12-15/h3-12H,1-2H3/b5-3+,10-6+,13-9+
Synonyms:- 3-Methyl-8-phenyl-3,5,7-octatrien-2-one
- 3,5,7-Octatrien-2-one, 3-methyl-8-phenyl-, (E,E,E)-
- (3E,5E,7E)-3-methyl-8-phenylocta-3,5,7-trien-2-one
- 3-Methyl-8-phenyl-(E,E,E)-3,5,7-octatrien-2-one
- Lignarenone B
- 3,5,7-Octatrien-2-one, 3-methyl-8-phenyl-, (3E,5E,7E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lignarenone B
CAS:Lignarenone B is a linear polyene extracted from the mantles of the mollusc Scaphander lignaruis.Formula:C15H16OColor and Shape:SolidMolecular weight:212.29
