CAS 125032-80-6

3-(Fluoromethyl)-3-pyrrolidinamine

Description:

3-(Fluoromethyl)-3-pyrrolidinamine, with the CAS number 125032-80-6, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The presence of a fluoromethyl group (-CH2F) at the 3-position of the pyrrolidine ring contributes to its unique reactivity and potential applications in medicinal chemistry. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It exhibits basic properties due to the amine functional group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The fluoromethyl group can enhance lipophilicity and influence the compound's biological activity, making it of interest in drug development and synthesis. Safety data should be consulted for handling, as the compound may pose health risks typical of amines and fluorinated compounds. Overall, 3-(Fluoromethyl)-3-pyrrolidinamine is a versatile building block in organic synthesis and pharmaceutical research.

Formula: C₅H₁₁FN₂

InChI: InChI=1S/C5H11FN2/c6-3-5(7)1-2-8-4-5/h8H,1-4,7H2

InChI key: InChIKey=NUVZFMCZBRTWDU-UHFFFAOYSA-N

SMILES: C(F)C1(N)CCNC1

Synonyms:

• 3-(Fluoromethyl)-3-pyrrolidinamine
• 3-Pyrrolidinamine, 3-(fluoromethyl)-
• 3-(Fluoromethyl)-3-aminopyrrolidine