CAS 125032-87-3

3-methylpyrrolidin-3-ol

Description:

3-Methylpyrrolidin-3-ol, with the CAS number 125032-87-3, is a cyclic organic compound characterized by a five-membered ring structure containing both nitrogen and hydroxyl functional groups. This compound features a methyl group attached to the third carbon of the pyrrolidine ring, which contributes to its unique properties. The presence of the hydroxyl (-OH) group indicates that it is an alcohol, which can influence its solubility and reactivity. Typically, compounds like 3-methylpyrrolidin-3-ol exhibit moderate polarity due to the hydroxyl group, making them soluble in polar solvents such as water and alcohols. Additionally, the nitrogen atom in the ring can participate in hydrogen bonding, further affecting its physical and chemical behavior. This compound may have applications in pharmaceuticals or as an intermediate in organic synthesis, although specific uses would depend on its reactivity and stability under various conditions. Overall, 3-methylpyrrolidin-3-ol is a versatile compound with potential significance in various chemical contexts.

Formula: C₅H₁₁NO

InChI: InChI=1/C5H11NO/c1-5(7)2-3-6-4-5/h6-7H,2-4H2,1H3

SMILES: CC1(CCNC1)O

3-Pyrrolidinol, 3-methyl-

CAS: 125032-87-3

Formula: C₅H₁₁NO

Purity: 98%

Color and Shape: Solid

Molecular weight: 101.1469

Ref: IN-DA000N0H

3-Methylpyrrolidin-3-ol

CAS: 125032-87-3

3-Methylpyrrolidin-3-ol

Formula: C₅H₁₁NO

Purity: 95%

Color and Shape: yellow fused solid

Molecular weight: 101.15g/mol

Ref: 54-OR480853

3-Methylpyrrolidin-3-ol

CAS: 125032-87-3

Formula: C₅H₁₁NO

Purity: 98%

Color and Shape: Liquid, No data available.

Molecular weight: 101.149

Ref: 10-F220081

3-Methylpyrrolidin-3-ol

CAS: 125032-87-3

Versatile small molecule scaffold

Formula: C₅H₁₁NO·HCl

Purity: Min. 95%

Molecular weight: 137.61 g/mol

Ref: 3D-AFA03287