CAS 125037-13-0
:3,7,11-Trimethyl-1,3,6,10-dodecatetraene
Description:
3,7,11-Trimethyl-1,3,6,10-dodecatetraene, with the CAS number 125037-13-0, is a hydrocarbon belonging to the class of terpenes, specifically a type of polyene. This compound features a long carbon chain with multiple double bonds, which contributes to its reactivity and potential applications in organic synthesis. The presence of three methyl groups at the 3, 7, and 11 positions enhances its structural complexity and influences its physical properties, such as boiling point and solubility. Typically, polyenes like this compound exhibit significant UV-Vis absorption due to their conjugated double bonds, making them interesting for studies in photochemistry and materials science. Additionally, the compound may possess unique olfactory characteristics, which could be relevant in the fragrance industry. Its stability and reactivity can vary depending on environmental conditions, such as temperature and the presence of light, which can lead to isomerization or degradation. Overall, 3,7,11-Trimethyl-1,3,6,10-dodecatetraene is a notable compound in the realm of organic chemistry with potential applications in various fields.
Formula:C15H24
InChI:InChI=1S/C15H24/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h6,9-10,12H,1,7-8,11H2,2-5H3
InChI key:InChIKey=CXENHBSYCFFKJS-UHFFFAOYSA-N
SMILES:C(=CCC=C(C=C)C)(CCC=C(C)C)C
Synonyms:- 3,7,11-Trimethyl-1,3,6,10-dodecatetraene
- 1,3,6,10-Dodecatetraene, 3,7,11-trimethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Farnesene - mixed isomers
CAS:Farnesene is a natural chemical found in many plants. It is used as a building block in organic chemistry, and is the most important terpene that has not been synthesized yet. Farnesene has been shown to have anti-inflammatory properties, and can be used as a reagent for research or as an intermediate for the synthesis of other compounds. It also has applications in the production of fragrance chemicals, plastics, and rubber products. Farnesene does not react with water or air, but reacts with strong oxidizing agents such as potassium permanganate.
Formula:C15H24Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:204.35 g/mol
