CAS 125040-55-3

2-(Bromomethyl)-imidazo[1,2-a]pyridine

Description:

2-(Bromomethyl)-imidazo[1,2-a]pyridine is a heterocyclic organic compound characterized by the presence of both an imidazole and a pyridine ring, which contributes to its unique chemical properties. The compound features a bromomethyl group, which enhances its reactivity, making it a useful intermediate in organic synthesis. It typically appears as a solid or liquid, depending on the specific conditions, and is soluble in polar organic solvents. The presence of the bromine atom allows for nucleophilic substitution reactions, facilitating the introduction of various functional groups. This compound is of interest in medicinal chemistry and material science due to its potential biological activity and utility in the development of pharmaceuticals. Additionally, its structural features may influence its electronic properties, making it a candidate for studies in coordination chemistry and catalysis. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of bromine and its potential reactivity.

Formula: C₈H₇BrN₂

InChI: InChI=1/C8H7BrN2/c9-5-7-6-11-4-2-1-3-8(11)10-7/h1-4,6H,5H2

2-(Bromomethyl)imidazo[1,2-a]pyridine

CAS: 125040-55-3

Formula: C₈H₈Br₂N₂

Molecular weight: 291.9705

Ref: IN-DA000N17