CAS 125040-56-4

Imidazo[1,2-a]pyridine, 2-(bromomethyl)-5-methyl-, hydrobromide (1:1)

Description:

Imidazo[1,2-a]pyridine, 2-(bromomethyl)-5-methyl-, hydrobromide (1:1) is a chemical compound characterized by its imidazo-pyridine structure, which features a fused imidazole and pyridine ring system. This compound contains a bromomethyl group at the 2-position and a methyl group at the 5-position of the imidazo[1,2-a]pyridine framework. The presence of the hydrobromide indicates that it exists as a salt, which can enhance its solubility in polar solvents. Typically, compounds of this nature exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The bromomethyl group can serve as a reactive site for further chemical modifications, potentially leading to the development of new therapeutic agents. Additionally, the imidazo[1,2-a]pyridine core is known for its role in various biological processes, including enzyme inhibition and receptor modulation. Overall, this compound's unique structure and functional groups contribute to its potential applications in drug discovery and development.

Formula: C₉H₉BrN₂·BrH

InChI: InChI=1S/C9H9BrN2.BrH/c1-7-3-2-4-9-11-8(5-10)6-12(7)9;/h2-4,6H,5H2,1H3;1H

InChI key: InChIKey=OUCMQQGQMAVCRQ-UHFFFAOYSA-N

SMILES: CC=1N2C(=NC(CBr)=C2)C=CC1.Br

Synonyms:

• Imidazo[1,2-a]pyridine, 2-(bromomethyl)-5-methyl-, monohydrobromide
• Imidazo[1,2-a]pyridine, 2-(bromomethyl)-5-methyl-, hydrobromide (1:1)
• 2-(bromomethyl)-5-methylimidazo[1,2-a]pyridine hydrobromide

2-(Bromomethyl)-5-methylimidazo[1,2-a]pyridine hydrobromide

CAS: 125040-56-4

Versatile small molecule scaffold

Formula: C₉H₁₀Br₂N₂

Purity: Min. 95%

Molecular weight: 306 g/mol

Ref: 3D-AFA04056