CymitQuimica logo

CAS 1250403-98-5

:

2-(3,5-Dimethyl-1H-1,2,4-triazol-1-yl)benzaldehyde

Description:
2-(3,5-Dimethyl-1H-1,2,4-triazol-1-yl)benzaldehyde is an organic compound characterized by its triazole and aldehyde functional groups. The presence of the triazole ring contributes to its potential biological activity, often associated with antifungal and antimicrobial properties. The benzaldehyde moiety provides aromatic characteristics, influencing its reactivity and solubility in organic solvents. This compound typically exhibits moderate stability under standard conditions but may be sensitive to light and moisture, which can affect its integrity. Its molecular structure allows for various chemical reactions, including nucleophilic additions and condensation reactions, making it a valuable intermediate in organic synthesis. Additionally, the presence of the dimethyl substituents on the triazole ring can enhance lipophilicity, potentially affecting its pharmacokinetic properties. Overall, 2-(3,5-Dimethyl-1H-1,2,4-triazol-1-yl)benzaldehyde is of interest in medicinal chemistry and material science due to its unique structural features and potential applications.
Formula:C11H11N3O
InChI:InChI=1S/C11H11N3O/c1-8-12-9(2)14(13-8)11-6-4-3-5-10(11)7-15/h3-7H,1-2H3
InChI key:InChIKey=WZINIJTVSISYJN-UHFFFAOYSA-N
SMILES:C(=O)C1=C(C=CC=C1)N2N=C(C)N=C2C
Synonyms:
  • Benzaldehyde, 2-(3,5-dimethyl-1H-1,2,4-triazol-1-yl)-
  • 2-(3,5-Dimethyl-1H-1,2,4-triazol-1-yl)benzaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.