CymitQuimica logo

CAS 1250405-63-0

:

6-(Methoxymethyl)-N-propyl-4-pyrimidinamine

Description:
6-(Methoxymethyl)-N-propyl-4-pyrimidinamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a methoxymethyl group and a propyl substituent, contributing to its unique chemical properties. The methoxymethyl group enhances solubility and may influence the compound's reactivity and interaction with biological targets. The presence of the amine functional group suggests potential basicity, allowing for hydrogen bonding and interactions with various biological molecules. This compound may exhibit pharmacological activity, making it of interest in medicinal chemistry, particularly in the development of therapeutics targeting specific biological pathways. Its molecular structure and substituents can significantly affect its pharmacokinetics, including absorption, distribution, metabolism, and excretion. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility would depend on the compound's purity and the conditions under which they are measured.
Formula:C9H15N3O
InChI:InChI=1S/C9H15N3O/c1-3-4-10-9-5-8(6-13-2)11-7-12-9/h5,7H,3-4,6H2,1-2H3,(H,10,11,12)
InChI key:InChIKey=BVPQRFRAHLRQMH-UHFFFAOYSA-N
SMILES:N(CCC)C=1C=C(COC)N=CN1
Synonyms:
  • 4-Pyrimidinamine, 6-(methoxymethyl)-N-propyl-
  • 6-(Methoxymethyl)-N-propyl-4-pyrimidinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.