
CAS 1250434-98-0
:1-Ethyl-4-(hydrazinylmethyl)-1H-pyrazole
Description:
1-Ethyl-4-(hydrazinylmethyl)-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features an ethyl group and a hydrazinylmethyl substituent, contributing to its unique reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the hydrazine functional group suggests that it may exhibit properties such as reducing ability and potential for forming coordination complexes. Additionally, the compound's structure may influence its solubility, stability, and interaction with biological targets. As with many nitrogen-containing heterocycles, it may also display interesting biological activities, making it a subject of interest for medicinal chemistry. Safety and handling precautions should be observed due to the potential toxicity associated with hydrazine derivatives. Overall, 1-Ethyl-4-(hydrazinylmethyl)-1H-pyrazole represents a versatile compound with implications in synthetic chemistry and drug development.
Formula:C6H12N4
InChI:InChI=1S/C6H12N4/c1-2-10-5-6(3-8-7)4-9-10/h4-5,8H,2-3,7H2,1H3
InChI key:InChIKey=GTSUJKKYAXYOFD-UHFFFAOYSA-N
SMILES:C(NN)C1=CN(CC)N=C1
Synonyms:- 1H-Pyrazole, 1-ethyl-4-(hydrazinylmethyl)-
- 1-Ethyl-4-(hydrazinylmethyl)-1H-pyrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.