CAS 125060-66-4: 6-iodo-N,N-dimethylpyrazin-2-amine

Description: 6-Iodo-N,N-dimethylpyrazin-2-amine is a chemical compound characterized by its pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of an iodine atom at the 6-position and two dimethylamino groups at the 2-position contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents due to the presence of the amino groups. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the pyrazine moiety is often found in biologically active compounds. The iodine substituent can also facilitate various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit interesting electronic properties due to the electron-donating nature of the dimethylamino groups, which can influence its behavior in biological systems or as a ligand in coordination chemistry. Overall, 6-iodo-N,N-dimethylpyrazin-2-amine is a versatile compound with potential applications in various fields of chemistry.

Formula: C₆H₈IN₃

InChI: InChI=1/C6H8IN3/c1-10(2)6-4-8-3-5(7)9-6/h3-4H,1-2H3

Synonyms:

• 2-Pyrazinamine, 6-iodo-N,N-dimethyl-

6-Iodo-N,N-dimethylpyrazin-2-amine

CAS: 125060-66-4

• Purity: 95+%
• Molecular weight: 249.05499267578125

2-(N,N-Dimethylamino)-6-iodopyrazine

CAS: 125060-66-4

Versatile small molecule scaffold

• Formula: C₆H₈IN₃
• Purity: Min. 95%
• Molecular weight: 249.05 g/mol