CAS 1250612-05-5

3-(2-Aminoethyl)-N,N-dimethylbenzamide

Description:

3-(2-Aminoethyl)-N,N-dimethylbenzamide, identified by its CAS number 1250612-05-5, is an organic compound characterized by its amide functional group, which is derived from benzamide. This compound features a benzene ring substituted with a dimethylamino group and an aminoethyl side chain, contributing to its potential biological activity. The presence of both the amine and amide functionalities suggests that it may engage in hydrogen bonding, influencing its solubility and reactivity. Typically, such compounds exhibit moderate polarity, making them soluble in polar solvents while retaining some lipophilicity due to the aromatic ring. The structural features may also suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, 3-(2-Aminoethyl)-N,N-dimethylbenzamide represents a versatile structure with implications in various chemical and biological contexts.

Formula: C₁₁H₁₆N₂O

InChI: InChI=1S/C11H16N2O/c1-13(2)11(14)10-5-3-4-9(8-10)6-7-12/h3-5,8H,6-7,12H2,1-2H3

InChI key: InChIKey=USSCVDBASHMYBP-UHFFFAOYSA-N

SMILES: C(N(C)C)(=O)C1=CC(CCN)=CC=C1

Synonyms:

• Benzamide, 3-(2-aminoethyl)-N,N-dimethyl-
• 3-(2-Aminoethyl)-N,N-dimethylbenzamide

3-(2-Aminoethyl)-N,N-dimethylbenzamide

CAS: 1250612-05-5

Versatile small molecule scaffold

Formula: C₁₁H₁₆N₂O

Purity: Min. 95%

Molecular weight: 192.26 g/mol

Ref: 3D-AAC61205