CAS 125068-54-4
:NSP 805
Description:
NSP 805, with the CAS number 125068-54-4, is a chemical compound that belongs to the class of sulfonamides. It is primarily recognized for its application in pharmaceutical research and development, particularly as a potential therapeutic agent. NSP 805 exhibits properties that may influence biological pathways, making it of interest in the study of various diseases. The compound is characterized by its specific molecular structure, which includes functional groups that contribute to its reactivity and biological activity. Additionally, NSP 805 may demonstrate solubility in certain organic solvents, which is relevant for its formulation in drug development. Safety and handling precautions are essential when working with this compound, as with many chemicals, due to potential toxicity or environmental impact. Overall, NSP 805 represents a significant area of interest in medicinal chemistry, with ongoing research aimed at elucidating its mechanisms of action and potential therapeutic benefits.
Formula:C17H19N3O2
InChI:InChI=1/C17H19N3O2/c1-10-9-16(22)19-20-17(10)12-3-5-13(6-4-12)18-14-7-8-15(21)11(14)2/h3-6,10,18H,7-9H2,1-2H3,(H,19,22)
SMILES:CC1CC(=NN=C1c1ccc(cc1)NC1=C(C)C(=O)CC1)O
Synonyms:- 4,5-Dihydro-5-methyl-6-(4-((2-methyl-3-oxo-1-cyclopentenyl)amino)phenyl)-3-(2H)-pyridazinone
- 3(2H)-Pyridazinone, 4,5-dihydro-5-methyl-6-(4-((2-methyl-3-oxo-1-cyclopenten-1-yl)amino)phenyl)-
- 5-methyl-6-{4-[(2-methyl-3-oxocyclopent-1-en-1-yl)amino]phenyl}-4,5-dihydropyridazin-3(2H)-one
- Nsp-805
- Nsp 805
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
NSP-805
CAS:NSP-805 is a potent and selective guinea pig cardiac phosphodiesterase 3 (PDE3) inhibitor.Formula:C17H19N3O2Purity:99.85%Color and Shape:SolidMolecular weight:297.35Ref: TM-T12267
1mg38.00€5mg86.00€1mL*10mM (DMSO)94.00€10mg129.00€25mg216.00€50mg309.00€100mg427.00€200mg577.00€3(2H)-Pyridazinone, 4,5-dihydro-5-methyl-6-[4-[(2-methyl-3-oxo-1-cyclopenten-1-yl)amino]phenyl]-
CAS:Formula:C17H19N3O2Purity:99%Color and Shape:SolidMolecular weight:297.3517NSP-805
CAS:NSP-805 is a calcium antagonist with inotropic and vasodilatory properties. It has been shown to be effective in the treatment of congestive heart failure, which is characterized by low cardiac output and high blood pressure. NSP-805 relaxes vascular smooth muscle cells, leading to vasodilation, and it can also prevent the formation of excessive amounts of phosphodiesterase. The drug is used at clinical doses for a limited time period to reduce the risk of heart attack or stroke.Formula:C17H19N3O2Purity:Min. 95%Molecular weight:297.35 g/mol



