CymitQuimica logo

CAS 125074-06-8

:

2-Methyl-1-(2,4,6-trihydroxyphenyl)-1-butanone

Description:
2-Methyl-1-(2,4,6-trihydroxyphenyl)-1-butanone, with the CAS number 125074-06-8, is an organic compound characterized by its complex structure featuring a butanone backbone substituted with a methyl group and a phenolic moiety that contains three hydroxyl groups. This compound is likely to exhibit properties typical of phenolic compounds, such as antioxidant activity, due to the presence of multiple hydroxyl groups on the aromatic ring. The methyl group contributes to its hydrophobic character, which may influence its solubility in various solvents. The presence of the ketone functional group suggests potential reactivity in nucleophilic addition reactions. Additionally, the compound may display biological activity, making it of interest in pharmaceutical and biochemical research. Its stability, reactivity, and potential applications can vary based on environmental conditions such as pH and temperature. Overall, 2-Methyl-1-(2,4,6-trihydroxyphenyl)-1-butanone represents a unique structure that may have significant implications in various fields, including medicinal chemistry and materials science.
Formula:C11H14O4
InChI:InChI=1S/C11H14O4/c1-3-6(2)11(15)10-8(13)4-7(12)5-9(10)14/h4-6,12-14H,3H2,1-2H3
InChI key:InChIKey=ASABIRFQGVWRDC-UHFFFAOYSA-N
SMILES:C(C(CC)C)(=O)C1=C(O)C=C(O)C=C1O
Synonyms:
  • 2-Methyl-1-(2,4,6-trihydroxyphenyl)-1-butanone
  • Multifidol
  • 1-Butanone, 2-methyl-1-(2,4,6-trihydroxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.