CAS 125096-15-3
:2-(10H-phenothiazin-10-yl)acetohydrazide
Description:
2-(10H-phenothiazin-10-yl)acetohydrazide, with the CAS number 125096-15-3, is a chemical compound that belongs to the class of phenothiazine derivatives. This substance features a phenothiazine moiety, which is characterized by a tricyclic structure containing sulfur and nitrogen atoms, contributing to its unique chemical properties. The presence of the acetohydrazide functional group indicates that it contains a hydrazine derivative, which can exhibit various biological activities. Typically, compounds of this nature may possess antimicrobial, anti-inflammatory, or antitumor properties, making them of interest in medicinal chemistry. The molecular structure allows for potential interactions with biological targets, influencing its pharmacological profile. Additionally, the compound may exhibit solubility in organic solvents, and its stability can be influenced by environmental factors such as pH and temperature. Overall, 2-(10H-phenothiazin-10-yl)acetohydrazide represents a significant area of study for researchers exploring therapeutic applications and the development of new pharmaceuticals.
Formula:C14H13N3OS
InChI:InChI=1/C14H13N3OS/c15-16-14(18)9-17-10-5-1-3-7-12(10)19-13-8-4-2-6-11(13)17/h1-8H,9,15H2,(H,16,18)
SMILES:c1ccc2c(c1)N(CC(=NN)O)c1ccccc1S2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
10H-Phenothiazine-10-acetic acid, hydrazide
CAS:Formula:C14H13N3OSPurity:97%Color and Shape:SolidMolecular weight:271.33752-(10H-Phenothiazin-10-Yl)Acetohydrazide
CAS:2-(10H-Phenothiazin-10-Yl)AcetohydrazidePurity:99%Molecular weight:271.34g/mol10HPhenothiazine-10-acetic acid, hydrazide
CAS:Please enquire for more information about 10HPhenothiazine-10-acetic acid, hydrazide including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C14H13N3OSPurity:Min. 95%Molecular weight:271.34 g/mol10H-Phenothiazine-10-acetic acid, hydrazide
CAS:10H-Phenothiazine-10-acetic acid, hydrazide is a fine chemical that is used as a versatile building block in the synthesis of complex compounds. It is also used as a reagent for research purposes, and can be used to prepare high quality products. 10H-Phenothiazine-10-acetic acid, hydrazide has CAS number 125096-15-3.Formula:C14H13N3OSPurity:Min. 85.0 Area-%Molecular weight:271.34 g/mol



