CAS 1250993-44-2

3-(3-Azetidinyl)cyclobutanecarboxylic acid

Description:

3-(3-Azetidinyl)cyclobutanecarboxylic acid is a chemical compound characterized by its unique bicyclic structure, which includes a cyclobutane ring and an azetidine moiety. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity in various chemical reactions. The presence of the azetidine ring, a four-membered nitrogen-containing heterocycle, may impart specific biological activities or pharmacological properties, making it of interest in medicinal chemistry. The compound's molecular structure suggests it could participate in hydrogen bonding due to the carboxylic acid group, influencing its solubility and interaction with biological targets. Additionally, the stereochemistry of the compound can play a significant role in its biological activity and interactions. As with many compounds containing nitrogen and carboxylic acid functionalities, it may exhibit polar characteristics, affecting its behavior in different solvents. Overall, 3-(3-Azetidinyl)cyclobutanecarboxylic acid represents a complex structure that could be explored for various applications in drug development and organic synthesis.

Formula: C₈H₁₃NO₂

InChI: InChI=1S/C8H13NO2/c10-8(11)6-1-5(2-6)7-3-9-4-7/h5-7,9H,1-4H2,(H,10,11)

InChI key: InChIKey=YHIHYOBIHHXDIY-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CC(C1)C2CNC2

Synonyms:

• Cyclobutanecarboxylic acid, 3-(3-azetidinyl)-
• 3-(3-Azetidinyl)cyclobutanecarboxylic acid