CymitQuimica logo

CAS 1250994-03-6

:

Ethyl 1-oxo-2-azaspiro[4.4]nonane-7-carboxylate

Description:
Ethyl 1-oxo-2-azaspiro[4.4]nonane-7-carboxylate is a chemical compound characterized by its unique spirocyclic structure, which features a nitrogen atom integrated into a bicyclic framework. This compound typically exhibits properties associated with both esters and amides due to the presence of the carboxylate group and the nitrogen atom. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the ethyl ester group suggests it may be relatively soluble in organic solvents, while the spirocyclic structure can impart interesting steric and electronic properties, potentially influencing its reactivity and interaction with biological systems. Such compounds may be of interest in medicinal chemistry and drug design due to their structural complexity and potential biological activity. However, specific data regarding its physical properties, reactivity, and applications would require further investigation through experimental studies or literature review.
Formula:C11H17NO3
InChI:InChI=1S/C11H17NO3/c1-2-15-9(13)8-3-4-11(7-8)5-6-12-10(11)14/h8H,2-7H2,1H3,(H,12,14)
InChI key:InChIKey=WLDMLAWRHZRLSX-UHFFFAOYSA-N
SMILES:O=C1C2(CC(C(OCC)=O)CC2)CCN1
Synonyms:
  • Ethyl 1-oxo-2-azaspiro[4.4]nonane-7-carboxylate
  • 2-Azaspiro[4.4]nonane-7-carboxylic acid, 1-oxo-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.