CAS 1250997-06-8

Ethyl 5-chloroimidazo[1,2-a]pyrazine-3-carboxylate

Description:

Ethyl 5-chloroimidazo[1,2-a]pyrazine-3-carboxylate is a chemical compound characterized by its imidazo[1,2-a]pyrazine core, which is a bicyclic structure containing both imidazole and pyrazine rings. This compound features a chloro substituent at the 5-position and an ethyl ester group at the 3-carboxylate position, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the chloro group can enhance the compound's biological activity and influence its interaction with various biological targets. Ethyl 5-chloroimidazo[1,2-a]pyrazine-3-carboxylate may exhibit properties such as solubility in organic solvents, moderate stability under standard conditions, and potential for further derivatization. Its unique structure suggests possible applications in drug development, particularly in the synthesis of compounds with antimicrobial or anticancer properties. As with many heterocyclic compounds, its behavior in biological systems and its pharmacokinetic properties would require thorough investigation to fully understand its potential uses.

Formula: C₉H₈ClN₃O₂

InChI: InChI=1S/C9H8ClN3O2/c1-2-15-9(14)6-3-12-8-5-11-4-7(10)13(6)8/h3-5H,2H2,1H3

InChI key: InChIKey=PIMMQTGIEFIFKE-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1N2C(=NC1)C=NC=C2Cl

Synonyms:

• Ethyl 5-chloroimidazo[1,2-a]pyrazine-3-carboxylate
• Imidazo[1,2-a]pyrazine-3-carboxylic acid, 5-chloro-, ethyl ester