CymitQuimica logo

CAS 1250999-71-3

:

2-(1,1-Dimethylethyl) 3,4-dihydro-2,7-naphthyridine-2,5(1H)-dicarboxylate

Description:
2-(1,1-Dimethylethyl) 3,4-dihydro-2,7-naphthyridine-2,5(1H)-dicarboxylate is a chemical compound characterized by its complex structure, which includes a naphthyridine core with two carboxylate functional groups and a tert-butyl substituent. This compound is likely to exhibit properties typical of naphthyridine derivatives, such as potential biological activity, including antimicrobial or anticancer properties, due to the presence of nitrogen in the heterocyclic ring. The dicarboxylate moiety may contribute to its solubility and reactivity, making it a candidate for various chemical reactions or applications in medicinal chemistry. Additionally, the tert-butyl group can influence the compound's steric hindrance and lipophilicity, affecting its interaction with biological targets. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including solvent, temperature, and pH. Further studies would be necessary to fully elucidate its properties and potential uses in various fields.
Formula:C14H18N2O4
InChI:InChI=1S/C14H18N2O4/c1-14(2,3)20-13(19)16-5-4-10-9(8-16)6-15-7-11(10)12(17)18/h6-7H,4-5,8H2,1-3H3,(H,17,18)
InChI key:InChIKey=USMOUCKEBWITHA-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(CN(C(OC(C)(C)C)=O)CC2)=CN=C1
Synonyms:
  • 2,7-Naphthyridine-2,5(1H)-dicarboxylic acid, 3,4-dihydro-, 2-(1,1-dimethylethyl) ester
  • 2-(1,1-Dimethylethyl) 3,4-dihydro-2,7-naphthyridine-2,5(1H)-dicarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.