CAS 1251000-26-6
:1,1-Dimethylethyl 5,6,7,9-tetrahydro-2-(methylthio)-8H-pyrimido[5,4-e][1,4]diazepine-8-carboxylate
Description:
1,1-Dimethylethyl 5,6,7,9-tetrahydro-2-(methylthio)-8H-pyrimido[5,4-e][1,4]diazepine-8-carboxylate is a complex organic compound characterized by its unique structural features, including a pyrimido-diazepine framework. This compound contains multiple functional groups, such as a carboxylate ester and a methylthio group, which contribute to its chemical reactivity and potential biological activity. The presence of the dimethyl group enhances its steric properties, potentially influencing its interactions with biological targets. The tetrahydro structure indicates that it is a saturated derivative, which may affect its solubility and stability. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its CAS number, 1251000-26-6, allows for precise identification in chemical databases. Overall, the characteristics of this compound suggest it could be relevant in various fields, including drug development and synthetic chemistry, although specific applications would depend on further research into its biological activity and chemical behavior.
Formula:C13H20N4O2S
InChI:InChI=1S/C13H20N4O2S/c1-13(2,3)19-12(18)17-6-5-14-9-7-15-11(20-4)16-10(9)8-17/h7,14H,5-6,8H2,1-4H3
InChI key:InChIKey=BUZHJCCPKMLOCZ-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC=2C(=CN=C(SC)N2)NCC1
Synonyms:- 1,1-Dimethylethyl 5,6,7,9-tetrahydro-2-(methylthio)-8H-pyrimido[5,4-e][1,4]diazepine-8-carboxylate
- 8H-Pyrimido[5,4-e][1,4]diazepine-8-carboxylic acid, 5,6,7,9-tetrahydro-2-(methylthio)-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.