CAS 1251001-32-7

1,1-Dimethylethyl 7-amino-2-azabicyclo[4.1.0]heptane-2-carboxylate

Description:

1,1-Dimethylethyl 7-amino-2-azabicyclo[4.1.0]heptane-2-carboxylate, identified by its CAS number 1251001-32-7, is a chemical compound characterized by its bicyclic structure, which includes a nitrogen atom in the ring, contributing to its classification as an azabicyclic compound. The presence of the dimethyl group at the 1-position enhances its steric properties, potentially influencing its reactivity and interaction with biological systems. The amino group at the 7-position suggests that this compound may exhibit basic properties, allowing it to participate in various chemical reactions, including those typical of amines. Additionally, the carboxylate functional group indicates that it can act as a weak acid, which may play a role in its solubility and reactivity in different solvents. Overall, this compound's unique structural features may make it of interest in medicinal chemistry and drug design, particularly in the development of compounds with specific biological activities. Further studies would be necessary to elucidate its full range of properties and potential applications.

Formula: C₁₁H₂₀N₂O₂

InChI: InChI=1S/C11H20N2O2/c1-11(2,3)15-10(14)13-6-4-5-7-8(12)9(7)13/h7-9H,4-6,12H2,1-3H3

InChI key: InChIKey=VACFVWQUAZOQDH-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1C2C(C2N)CCC1

Synonyms:

• 1,1-Dimethylethyl 7-amino-2-azabicyclo[4.1.0]heptane-2-carboxylate
• 2-Azabicyclo[4.1.0]heptane-2-carboxylic acid, 7-amino-, 1,1-dimethylethyl ester

tert-Butyl 7-amino-5-azabicyclo[4.1.0]heptane-5-carboxylate

CAS: 1251001-32-7

Versatile small molecule scaffold

Formula: C₁₁H₂₀N₂O₂

Purity: Min. 95%

Molecular weight: 212.29 g/mol

Ref: 3D-BAC00132