CymitQuimica logo

CAS 1251001-42-9

:

1,1-Dimethylethyl 3,4,6,7-tetrahydro-4-(hydroxymethyl)-3-(1-methylethyl)-5H-imidazo[4,5-c]pyridine-5-carboxylate

Description:
1,1-Dimethylethyl 3,4,6,7-tetrahydro-4-(hydroxymethyl)-3-(1-methylethyl)-5H-imidazo[4,5-c]pyridine-5-carboxylate, identified by its CAS number 1251001-42-9, is a complex organic compound characterized by its imidazopyridine structure, which incorporates a carboxylate functional group and multiple substituents. This compound features a tetrahydro configuration, indicating a saturated ring system, and includes hydroxymethyl and dimethyl groups that contribute to its chemical reactivity and potential biological activity. The presence of the imidazo[4,5-c]pyridine moiety suggests potential pharmacological properties, as many compounds in this class are known for their roles in medicinal chemistry. Its molecular structure implies that it may exhibit specific interactions with biological targets, making it of interest in drug development. Additionally, the presence of bulky groups like the tert-butyl (1,1-dimethylethyl) moiety may influence its solubility and lipophilicity, affecting its bioavailability and pharmacokinetics. Overall, this compound represents a unique scaffold for further investigation in various chemical and biological applications.
Formula:C15H25N3O3
InChI:InChI=1S/C15H25N3O3/c1-10(2)18-9-16-11-6-7-17(12(8-19)13(11)18)14(20)21-15(3,4)5/h9-10,12,19H,6-8H2,1-5H3
InChI key:InChIKey=JMBRLGSSSJULSD-UHFFFAOYSA-N
SMILES:C(O)C1C2=C(CCN1C(OC(C)(C)C)=O)N=CN2C(C)C
Synonyms:
  • 1,1-Dimethylethyl 3,4,6,7-tetrahydro-4-(hydroxymethyl)-3-(1-methylethyl)-5H-imidazo[4,5-c]pyridine-5-carboxylate
  • 5H-Imidazo[4,5-c]pyridine-5-carboxylic acid, 3,4,6,7-tetrahydro-4-(hydroxymethyl)-3-(1-methylethyl)-, 1,1-dimethylethyl ester
Found 2 products.