CAS 1251002-30-8

1,1-Dimethylethyl 3-(hydroxymethyl)-2-oxa-7-azaspiro[4.5]decane-7-carboxylate

Description:

1,1-Dimethylethyl 3-(hydroxymethyl)-2-oxa-7-azaspiro[4.5]decane-7-carboxylate, identified by its CAS number 1251002-30-8, is a chemical compound characterized by its complex spirocyclic structure, which includes both an oxo and an azaspiro moiety. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility in various solvents. The presence of the hydroxymethyl group suggests it may participate in hydrogen bonding, influencing its physical properties and interactions. The dimethyl substituent on the nitrogen atom enhances steric hindrance, which can affect the compound's conformation and biological activity. Such structural features may render it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound's unique arrangement of functional groups may impart specific properties such as lipophilicity or hydrophilicity, which are crucial for its behavior in biological systems. Overall, this compound's intricate structure and functional diversity make it a subject of interest for further research and application in various chemical fields.

Formula: C₁₄H₂₅NO₄

InChI: InChI=1S/C14H25NO4/c1-13(2,3)19-12(17)15-6-4-5-14(9-15)7-11(8-16)18-10-14/h11,16H,4-10H2,1-3H3

InChI key: InChIKey=QFZWHSBESNSOMV-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC2(CC(CO)OC2)CCC1

Synonyms:

• 2-Oxa-7-azaspiro[4.5]decane-7-carboxylic acid, 3-(hydroxymethyl)-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 3-(hydroxymethyl)-2-oxa-7-azaspiro[4.5]decane-7-carboxylate

tert-Butyl 3-(hydroxymethyl)-2-oxa-7-azaspiro[4.5]decane-7-carboxylate

CAS: 1251002-30-8

Formula: C₁₄H₂₅NO₄

Purity: 95%

Molecular weight: 271.3526

Ref: IN-DA00HHZE

tert-Butyl 3-(hydroxymethyl)-2-oxa-7-azaspiro[4.5]decane-7-carboxylate

CAS: 1251002-30-8

Purity: 95%

Molecular weight: 271.3569946

Ref: 10-F601943