CAS 1251010-77-1

3-(1,1-Dimethylethyl) 8-oxa-3-azabicyclo[3.2.1]octane-3,6-dicarboxylate

Description:

3-(1,1-Dimethylethyl) 8-oxa-3-azabicyclo[3.2.1]octane-3,6-dicarboxylate is a chemical compound characterized by its bicyclic structure, which includes both an oxygen and a nitrogen atom within the ring system. The presence of the 1,1-dimethylethyl group contributes to its steric bulk, potentially influencing its reactivity and interactions with other molecules. This compound features two carboxylate functional groups, which can participate in various chemical reactions, including esterification and salt formation. The bicyclic framework suggests potential applications in medicinal chemistry, particularly in the design of pharmaceuticals, due to its structural complexity and the ability to modify functional groups for enhanced biological activity. Additionally, the compound's unique structure may impart specific physical properties, such as solubility and stability, which are critical for its application in various chemical contexts. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior, making it a subject of interest in both synthetic and applied chemistry.

Formula: C₁₂H₁₉NO₅

InChI: InChI=1S/C12H19NO5/c1-12(2,3)18-11(16)13-5-7-4-8(10(14)15)9(6-13)17-7/h7-9H,4-6H2,1-3H3,(H,14,15)

InChI key: InChIKey=HZNSXHWBKZWPAT-UHFFFAOYSA-N

SMILES: C(O)(=O)C1C2CN(C(OC(C)(C)C)=O)CC(O2)C1

Synonyms:

• 3-(1,1-Dimethylethyl) 8-oxa-3-azabicyclo[3.2.1]octane-3,6-dicarboxylate
• 8-Oxa-3-azabicyclo[3.2.1]octane-3,6-dicarboxylic acid, 3-(1,1-dimethylethyl) ester

3-[(tert-Butoxy)carbonyl]-8-oxa-3-azabicyclo[3.2.1]octane-6-carboxylic acid

CAS: 1251010-77-1

Versatile small molecule scaffold

Formula: C₁₂H₁₉NO₅

Purity: Min. 95%

Molecular weight: 257.28 g/mol

Ref: 3D-BAC01077