CAS 1251014-36-4

rel-1,1-Dimethylethyl (3R,3aR,6aS)-hexahydro-3-hydroxy-1H-furo[3,4-b]pyrrole-1-carboxylate

Description:

Rel-1,1-Dimethylethyl (3R,3aR,6aS)-hexahydro-3-hydroxy-1H-furo[3,4-b]pyrrole-1-carboxylate, with CAS number 1251014-36-4, is a chemical compound characterized by its complex bicyclic structure, which includes a furo[3,4-b]pyrrole moiety. This compound features a hexahydro framework, indicating it is saturated and contains multiple chiral centers, contributing to its stereochemical specificity. The presence of a hydroxyl group suggests potential for hydrogen bonding, influencing its solubility and reactivity. The dimethylethyl group indicates a branched alkyl substituent, which can affect the compound's lipophilicity and overall stability. Such structural features may impart biological activity, making it of interest in medicinal chemistry and pharmacology. The compound's properties, including melting point, boiling point, and solubility, would typically be determined through experimental methods, and its behavior in various chemical environments could be explored through further studies. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly those with potential therapeutic applications.

Formula: C₁₁H₁₉NO₄

InChI: InChI=1/C11H19NO4/c1-11(2,3)16-10(14)12-4-9(13)7-5-15-6-8(7)12/h7-9,13H,4-6H2,1-3H3/t7-,8+,9-/s2

InChI key: InChIKey=PFUPMNIOAZUCHN-DSYSRCFZNA-N

SMILES: C(OC(C)(C)C)(=O)N1[C@]2([C@@]([C@@H](O)C1)(COC2)[H])[H]

Synonyms:

• 1H-Furo[3,4-b]pyrrole-1-carboxylic acid, hexahydro-3-hydroxy-, 1,1-dimethylethyl ester, (3R,3aR,6aS)-rel-
• rel-1,1-Dimethylethyl (3R,3aR,6aS)-hexahydro-3-hydroxy-1H-furo[3,4-b]pyrrole-1-carboxylate