CymitQuimica logo

CAS 1251015-37-8

:

1-(2-Chloro-4-pyridinyl)-2,3,4,5-tetrahydro-1H-2-benzazepine

Description:
1-(2-Chloro-4-pyridinyl)-2,3,4,5-tetrahydro-1H-2-benzazepine is a chemical compound characterized by its complex structure, which includes a benzazepine core fused with a pyridine ring. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of nitrogen atoms in its structure. The chloro substituent on the pyridine ring can influence its reactivity and interaction with biological targets. The tetrahydro configuration indicates that the compound has multiple saturated carbon atoms, contributing to its stability and potentially affecting its solubility and lipophilicity. Such compounds are often investigated for their pharmacological properties, including potential applications in treating neurological or psychiatric disorders. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the compound's purity and the conditions under which it is studied. Overall, this compound represents a class of molecules that may have significant implications in medicinal chemistry and drug development.
Formula:C15H15ClN2
InChI:InChI=1S/C15H15ClN2/c16-14-10-12(7-9-17-14)15-13-6-2-1-4-11(13)5-3-8-18-15/h1-2,4,6-7,9-10,15,18H,3,5,8H2
InChI key:InChIKey=ZLRVXZOYGMHSMO-UHFFFAOYSA-N
SMILES:ClC1=CC(C2C=3C(=CC=CC3)CCCN2)=CC=N1
Synonyms:
  • 1-(2-Chloro-4-pyridinyl)-2,3,4,5-tetrahydro-1H-2-benzazepine
  • 1H-2-Benzazepine, 1-(2-chloro-4-pyridinyl)-2,3,4,5-tetrahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.