CAS 1251017-50-1
:4-(1H-1,2,3-Triazol-5-yl)piperidine
Description:
4-(1H-1,2,3-Triazol-5-yl)piperidine is a chemical compound characterized by the presence of a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, and a triazole moiety, a five-membered ring containing three nitrogen atoms. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of nitrogen atoms, which can engage in hydrogen bonding. The triazole group is known for its biological activity, often serving as a bioisostere for other functional groups in medicinal chemistry. The piperidine ring contributes to the compound's basicity and can influence its pharmacokinetic properties. Additionally, the compound may exhibit potential applications in pharmaceuticals, particularly in the development of antimicrobial or antifungal agents, owing to the biological relevance of both the piperidine and triazole structures. Its unique structural features make it a subject of interest in various fields, including medicinal chemistry and material science.
Formula:C7H12N4
InChI:InChI=1S/C7H12N4/c1-3-8-4-2-6(1)7-5-9-11-10-7/h5-6,8H,1-4H2,(H,9,10,11)
InChI key:InChIKey=LGIWBPLJDKOQSX-UHFFFAOYSA-N
SMILES:C1(=CN=NN1)C2CCNCC2
Synonyms:- 4-(1H-1,2,3-Triazol-5-yl)piperidine
- Piperidine, 4-(1H-1,2,3-triazol-5-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.