CAS 1251021-44-9

1,1-Dimethylethyl 1,4-dihydro-1-oxospiro[isoquinoline-3(2H),4′-piperidine]-1′-carboxylate

Description:

1,1-Dimethylethyl 1,4-dihydro-1-oxospiro[isoquinoline-3(2H),4′-piperidine]-1′-carboxylate, with the CAS number 1251021-44-9, is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both isoquinoline and piperidine moieties. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility properties. The presence of the 1,1-dimethylethyl group suggests steric hindrance, which may influence its biological activity and interactions with other molecules. The dihydro-1-oxo group indicates that it may participate in various chemical reactions, including those typical of carbonyl compounds. Its structural complexity may confer interesting pharmacological properties, making it a candidate for further investigation in medicinal chemistry. Overall, the characteristics of this compound suggest potential applications in drug development, although specific biological activities and properties would require empirical studies to elucidate.

Formula: C₁₈H₂₄N₂O₃

InChI: InChI=1S/C18H24N2O3/c1-17(2,3)23-16(22)20-10-8-18(9-11-20)12-13-6-4-5-7-14(13)15(21)19-18/h4-7H,8-12H2,1-3H3,(H,19,21)

InChI key: InChIKey=SXIPQAKGHJILBH-UHFFFAOYSA-N

SMILES: O=C1NC2(CC=3C1=CC=CC3)CCN(C(OC(C)(C)C)=O)CC2

Synonyms:

• Spiro[isoquinoline-3(2H),4′-piperidine]-1′-carboxylic acid, 1,4-dihydro-1-oxo-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 1,4-dihydro-1-oxospiro[isoquinoline-3(2H),4′-piperidine]-1′-carboxylate