CymitQuimica logo

CAS 1251021-48-3

:

rel-1-Ethyl 2-(phenylmethyl) (1R,3aS,4S,6aR)-4-aminohexahydrocyclopenta[c]pyrrole-1,2(1H)-dicarboxylate

Description:
Rel-1-Ethyl 2-(phenylmethyl) (1R,3aS,4S,6aR)-4-aminohexahydrocyclopenta[c]pyrrole-1,2(1H)-dicarboxylate is a complex organic compound characterized by its multi-cyclic structure and the presence of multiple functional groups, including amino and carboxylate moieties. This compound features a hexahydrocyclopenta[c]pyrrole core, which contributes to its potential biological activity and interaction with various biological targets. The presence of an ethyl group and a phenylmethyl substituent enhances its lipophilicity, potentially influencing its pharmacokinetic properties. The stereochemistry indicated by the (1R,3aS,4S,6aR) configuration suggests specific spatial arrangements that may be crucial for its biological function or activity. As a dicarboxylate, it may participate in various chemical reactions, including esterification and amidation. The compound's unique structure and functional groups make it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific receptors or pathways. Further studies would be necessary to elucidate its full range of properties and potential applications.
Formula:C18H24N2O4
InChI:InChI=1/C18H24N2O4/c1-2-23-17(21)16-13-8-9-15(19)14(13)10-20(16)18(22)24-11-12-6-4-3-5-7-12/h3-7,13-16H,2,8-11,19H2,1H3/t13-,14-,15+,16-/s2
InChI key:InChIKey=CFLWNOAOPASYSF-RIVOXVKVNA-N
SMILES:C(OCC)(=O)[C@@H]1[C@@]2([C@](CN1C(OCC3=CC=CC=C3)=O)([C@H](N)CC2)[H])[H]
Synonyms:
  • rel-1-Ethyl 2-(phenylmethyl) (1R,3aS,4S,6aR)-4-aminohexahydrocyclopenta[c]pyrrole-1,2(1H)-dicarboxylate
  • Cyclopenta[c]pyrrole-1,2(1H)-dicarboxylic acid, 4-aminohexahydro-, 1-ethyl 2-(phenylmethyl) ester, (1R,3aS,4S,6aR)-rel-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.