CymitQuimica logo

CAS 1251022-86-2

:

5-Oxa-2-azaspiro[3.4]octane-2-carboxylic acid, 6-(aminomethyl)-, 1,1-dimethylethyl ester

Description:
5-Oxa-2-azaspiro[3.4]octane-2-carboxylic acid, 6-(aminomethyl)-, 1,1-dimethylethyl ester, identified by CAS number 1251022-86-2, is a chemical compound characterized by its unique spirocyclic structure, which incorporates both an oxirane and an azaspiro framework. This compound features a carboxylic acid moiety, which is esterified with a tert-butyl group, enhancing its lipophilicity and potentially influencing its biological activity. The presence of an aminomethyl group suggests that it may participate in various chemical reactions, including amine-related transformations. Its structural complexity may contribute to interesting pharmacological properties, making it a candidate for further investigation in medicinal chemistry. Additionally, the compound's stability, solubility, and reactivity can be influenced by the functional groups present, which may affect its applications in drug development or as a synthetic intermediate. Overall, this compound exemplifies the diverse chemistry associated with spirocyclic compounds and their potential utility in various fields.
Formula:C12H22N2O3
InChI:InChI=1S/C12H22N2O3/c1-11(2,3)17-10(15)14-7-12(8-14)5-4-9(6-13)16-12/h9H,4-8,13H2,1-3H3
InChI key:InChIKey=LDLGEBQAVINBNL-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC2(C1)OC(CN)CC2
Synonyms:
  • tert-Butyl 6-(aminomethyl)-5-oxa-2-azaspiro[3.4]octane-2-carboxylate
  • 5-Oxa-2-azaspiro[3.4]octane-2-carboxylic acid, 6-(aminomethyl)-, 1,1-dimethylethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.