
CAS 1251022-87-3
:2-(1,1-Dimethylethyl) 6-oxa-2-azaspiro[3.5]nonane-2,7-dicarboxylate
Description:
2-(1,1-Dimethylethyl) 6-oxa-2-azaspiro[3.5]nonane-2,7-dicarboxylate is a chemical compound characterized by its unique spirocyclic structure, which includes both an azaspiro and an oxa functional group. This compound features a tert-butyl group (1,1-dimethylethyl) that contributes to its steric bulk, potentially influencing its reactivity and interactions with other molecules. The presence of two carboxylate groups indicates that it can participate in various chemical reactions, including esterification and acid-base reactions. Its spirocyclic nature may impart specific conformational properties, affecting its biological activity and solubility. The compound is likely to be of interest in medicinal chemistry or materials science due to its structural complexity and potential applications. As with many organic compounds, its stability, reactivity, and interactions will depend on environmental factors such as pH, temperature, and the presence of solvents or other reagents. Safety data and handling precautions should be consulted when working with this substance, as with any chemical compound.
Formula:C13H21NO5
InChI:InChI=1S/C13H21NO5/c1-12(2,3)19-11(17)14-6-13(7-14)5-4-9(10(15)16)18-8-13/h9H,4-8H2,1-3H3,(H,15,16)
InChI key:InChIKey=SRYYLHVDTOXDGH-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC2(C1)CCC(C(O)=O)OC2
Synonyms:- 2-(1,1-Dimethylethyl) 6-oxa-2-azaspiro[3.5]nonane-2,7-dicarboxylate
- 6-Oxa-2-azaspiro[3.5]nonane-2,7-dicarboxylic acid, 2-(1,1-dimethylethyl) ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.