CAS 1251032-66-2
:Methyl 7-fluoro-2,3-dihydro-2-oxo-1H-indole-6-carboxylate
Description:
Methyl 7-fluoro-2,3-dihydro-2-oxo-1H-indole-6-carboxylate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a methyl ester group at the carboxylate position enhances its solubility in organic solvents and may influence its biological activity. The 7-fluoro substitution introduces a fluorine atom, which can significantly affect the compound's electronic properties, lipophilicity, and potential interactions with biological targets. The dihydro and keto functionalities contribute to its reactivity and may play a role in its pharmacological properties. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as modifications to the indole core can lead to diverse biological activities. Its specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods and are essential for understanding its behavior in various chemical contexts.
Formula:C10H8FNO3
InChI:InChI=1S/C10H8FNO3/c1-15-10(14)6-3-2-5-4-7(13)12-9(5)8(6)11/h2-3H,4H2,1H3,(H,12,13)
InChI key:InChIKey=NBVHYHLSWKPFBS-UHFFFAOYSA-N
SMILES:FC1=C2C(=CC=C1C(OC)=O)CC(=O)N2
Synonyms:- 1H-Indole-6-carboxylic acid, 7-fluoro-2,3-dihydro-2-oxo-, methyl ester
- Methyl 7-fluoro-2,3-dihydro-2-oxo-1H-indole-6-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
