
CAS 125104-37-2
:Methyl 2-(1-pyrrolidinylmethyl)-4-pyridinecarboxylate
Description:
Methyl 2-(1-pyrrolidinylmethyl)-4-pyridinecarboxylate, with the CAS number 125104-37-2, is a chemical compound characterized by its pyridine and pyrrolidine functional groups. It features a methyl ester functional group, which contributes to its solubility in organic solvents. The presence of the pyridine ring imparts basic properties, while the pyrrolidine moiety can influence its reactivity and biological activity. This compound is typically a white to off-white solid or a viscous liquid, depending on its purity and specific conditions. It may exhibit moderate to high polarity due to the carboxylate group, affecting its interactions in various chemical environments. Methyl 2-(1-pyrrolidinylmethyl)-4-pyridinecarboxylate is of interest in medicinal chemistry and may have potential applications in drug development, particularly in the synthesis of compounds with pharmacological activity. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C12H16N2O2
InChI:InChI=1S/C12H16N2O2/c1-16-12(15)10-4-5-13-11(8-10)9-14-6-2-3-7-14/h4-5,8H,2-3,6-7,9H2,1H3
InChI key:InChIKey=OAIQKJZUUQREHD-UHFFFAOYSA-N
SMILES:C(C1=CC(C(OC)=O)=CC=N1)N2CCCC2
Synonyms:- 4-Pyridinecarboxylic acid, 2-(1-pyrrolidinylmethyl)-, methyl ester
- Methyl 2-(1-pyrrolidinylmethyl)-4-pyridinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
