CAS 125106-42-5

3,4-Diamino-N-methylbenzenesulfonamide

Description:

3,4-Diamino-N-methylbenzenesulfonamide, also known as a sulfonamide antibiotic, is characterized by its sulfonamide functional group, which is a key feature of many antibacterial agents. This compound contains two amino groups (-NH2) positioned at the 3 and 4 positions on a benzene ring, along with a methyl group attached to the nitrogen of the sulfonamide moiety. Its structure contributes to its solubility in water and its ability to interact with bacterial enzymes, inhibiting folic acid synthesis, which is crucial for bacterial growth. The presence of the sulfonamide group enhances its pharmacological properties, making it effective against a range of bacterial infections. Additionally, this compound may exhibit properties such as moderate stability under standard conditions and potential reactivity with electrophiles due to the amino groups. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or allergic reactions associated with sulfonamides. Overall, 3,4-Diamino-N-methylbenzenesulfonamide is an important compound in medicinal chemistry, particularly in the development of antimicrobial therapies.

Formula: C₇H₁₁N₃O₂S

InChI: InChI=1S/C7H11N3O2S/c1-10-13(11,12)5-2-3-6(8)7(9)4-5/h2-4,10H,8-9H2,1H3

InChI key: InChIKey=HCDDNUWDHVVUSG-UHFFFAOYSA-N

SMILES: S(NC)(=O)(=O)C1=CC(N)=C(N)C=C1

Synonyms:

• 3,4-Diamino-N-methylbenzenesulfonamide
• 3,4-Diamino-N-methylbenzene-1-sulfonamide
• Benzenesulfonamide, 3,4-diamino-N-methyl-

3,4-Diamino-N-methylbenzene-1-sulfonamide

CAS: 125106-42-5

Versatile small molecule scaffold

Formula: C₇H₁₁N₃O₂S

Purity: Min. 95%

Molecular weight: 201.25 g/mol

Ref: 3D-AFA10642