CAS 125108-66-9
:furaquinocin A
Description:
Furaquinocin A is a naturally occurring compound classified as a quinone, specifically a member of the furaquinocin family. It is known for its complex bicyclic structure, which contributes to its biological activity. This compound exhibits notable antimicrobial properties, making it of interest in pharmaceutical research, particularly for its potential applications in treating infections. Furaquinocin A has been studied for its ability to inhibit certain enzymes and disrupt cellular processes in target organisms. Its mechanism of action often involves the generation of reactive oxygen species, which can lead to oxidative stress in microbial cells. Additionally, furaquinocin A may exhibit cytotoxic effects against various cancer cell lines, highlighting its potential as an anticancer agent. The compound's solubility and stability in different solvents can vary, influencing its bioavailability and efficacy in therapeutic applications. Overall, furaquinocin A represents a significant area of study in natural product chemistry and drug development, with ongoing research aimed at elucidating its full range of biological activities and potential therapeutic uses.
Formula:C22H26O7
InChI:InChI=1/C22H26O7/c1-10(9-23)6-7-15(25)22(4)12(3)29-21-16-13(8-14(24)17(21)22)19(27)20(28-5)11(2)18(16)26/h6,8,12,15,23-25H,7,9H2,1-5H3/b10-6+
Synonyms:- furaquinocin A
- 3-(1,5-Dihydroxy-4-methyl-3-pentenyl)-2,3-dihydro-4-hydroxy-7-methoxy-2,3,8-trimethylnaphtho(1,2-b)furan-6,9-dione
- Furaquinocin A
- 3-[(3E)-1,5-dihydroxy-4-methylpent-3-en-1-yl]-4-hydroxy-7-methoxy-2,3,8-trimethyl-2,3-dihydronaphtho[1,2-b]furan-6,9-dione
- Naphtho[1,2-b]furan-6,9-dione, 3-[(1R,3Z)-1,5-dihydroxy-4-methyl-3-penten-1-yl]-2,3-dihydro-4-hydroxy-7-methoxy-2,3,8-trimethyl-, (2R,3S)-
- (2R)-2α,3,8-Trimethyl-3α-[(1R,3Z)-1,5-dihydroxy-4-methyl-3-pentenyl]-4-hydroxy-7-methoxy-2,3,6,9-tetrahydronaphtho[1,2-b]furan-6,9-dione
- (2R,3S)-2,3-Dihydro-4-hydroxy-3-[(1R,3Z)-1,5-dihydroxy-4-methyl-3-pentenyl]-2,3,8-trimethyl-7-methoxynaphtho[1,2-b]furan-6,9-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Furaquinocin A
CAS:<p>Furaquinocin A has the ability to kill HeLa S3 and B16 melanoma cells, yet it lacks antibacterial activity.</p>Formula:C22H26O7Color and Shape:SolidMolecular weight:402.438
