CAS 125109-84-4

β-Methyl-3-(1-methylethenyl)benzenepropanal

Description:

β-Methyl-3-(1-methylethenyl)benzenepropanal, also known by its CAS number 125109-84-4, is an organic compound characterized by its complex structure, which includes a propanal group attached to a substituted aromatic ring. This compound features a β-methyl group and a vinyl group, contributing to its unique reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid with a distinctive odor, indicative of its aromatic nature. The presence of both aliphatic and aromatic components suggests that it may exhibit interesting chemical properties, such as reactivity in electrophilic aromatic substitution reactions or potential use as a fragrance or flavoring agent. Its solubility in organic solvents and limited solubility in water are typical for such compounds, making it suitable for various applications in the chemical industry. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.

Formula: C₁₃H₁₆O

InChI: InChI=1S/C13H16O/c1-10(2)12-5-4-6-13(9-12)11(3)7-8-14/h4-6,8-9,11H,1,7H2,2-3H3

InChI key: InChIKey=YYANKIXCOSAFMF-UHFFFAOYSA-N

SMILES: C(CC=O)(C)C1=CC(C(C)=C)=CC=C1

Synonyms:

• Benzenepropanal, β-methyl-3-(1-methylethenyl)-
• β-Methyl-3-(1-methylethenyl)benzenepropanal