CAS 1251105-57-3

2-Methyl-6-(1H-pyrrol-1-ylmethyl)pyridine

Description:

2-Methyl-6-(1H-pyrrol-1-ylmethyl)pyridine is an organic compound characterized by its pyridine and pyrrole functional groups. It features a methyl group at the 2-position and a pyrrol-1-ylmethyl substituent at the 6-position of the pyridine ring. This compound is likely to exhibit properties typical of nitrogen-containing heterocycles, such as basicity and potential for hydrogen bonding due to the presence of nitrogen atoms. Its structure suggests it may participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic attacks, owing to the electron-rich nature of the pyrrole moiety. Additionally, the presence of both aromatic and aliphatic components may contribute to its solubility in organic solvents. The compound's potential applications could span fields such as pharmaceuticals, agrochemicals, or materials science, where its unique structural features may impart specific biological or chemical activities. However, detailed studies would be necessary to fully elucidate its reactivity, stability, and potential uses in various applications.

Formula: C₁₁H₁₂N₂

InChI: InChI=1S/C11H12N2/c1-10-5-4-6-11(12-10)9-13-7-2-3-8-13/h2-8H,9H2,1H3

InChI key: InChIKey=BZPXERHFIAKMSL-UHFFFAOYSA-N

SMILES: C(C=1N=C(C)C=CC1)N2C=CC=C2

Synonyms:

• Pyridine, 2-methyl-6-(1H-pyrrol-1-ylmethyl)-
• 2-Methyl-6-(1H-pyrrol-1-ylmethyl)pyridine