CAS 125112-67-6
:1-iodoperfluoro-1-methylcyclopentane
Description:
1-Iodoperfluoro-1-methylcyclopentane is a perfluorinated organic compound characterized by the presence of iodine and a cyclopentane ring structure. It features a fully fluorinated carbon backbone, which imparts unique chemical properties such as high thermal stability, low surface tension, and resistance to chemical reactions, making it hydrophobic and lipophobic. The iodine atom introduces a polar functional group, which can influence its reactivity and interactions with other substances. This compound is typically colorless and may exhibit low volatility due to its fluorinated nature. Its applications may include use in specialized chemical syntheses, as a solvent, or in materials science, particularly in contexts where non-reactivity and stability are paramount. However, due to the environmental concerns associated with perfluorinated compounds, including potential bioaccumulation and persistence in the environment, its use may be subject to regulatory scrutiny. Overall, 1-iodoperfluoro-1-methylcyclopentane exemplifies the unique properties of fluorinated compounds, combining stability with specific functional characteristics.
Formula:C6F11I
InChI:InChI=1/C6F11I/c7-2(8)1(18,6(15,16)17)3(9,10)5(13,14)4(2,11)12
SMILES:C1(C(C(C(C1(F)F)(F)F)(F)F)(F)F)(C(F)(F)F)I
Synonyms:- Perfluoro(1-iodo-1-methylcyclopentane)
- 1,1,2,2,3,3,4,4-Octafluoro-5-Iodo-5-(Trifluoromethyl)Cyclopentane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cyclopentane, 1,1,2,2,3,3,4,4-octafluoro-5-iodo-5-(trifluoromethyl)-
CAS:Formula:C6F11IMolecular weight:407.9511
