CAS 125118-77-6
:Galanin (1-16) (porcine, rat)
Description:
Galanin (1-16) is a neuropeptide that consists of a sequence of 16 amino acids and is derived from the larger galanin precursor. It is known to play a significant role in various physiological processes, including modulation of neurotransmission, regulation of mood, and control of pain perception. This peptide is particularly notable for its involvement in the central nervous system and peripheral tissues, influencing functions such as feeding behavior, circadian rhythms, and reproductive processes. The porcine and rat variants indicate its sources from these species, which are often used in research due to their physiological similarities to humans. Galanin (1-16) interacts with specific galanin receptors, leading to diverse biological effects depending on the receptor subtype activated. The CAS number 125118-77-6 uniquely identifies this compound, facilitating its recognition in scientific literature and databases. Overall, galanin (1-16) is a crucial molecule in neurobiology, with ongoing research exploring its therapeutic potential in various neurological disorders.
Formula:C78H116N20O21
InChI:InChI=1/C78H116N20O21/c1-12-41(8)64(78(118)119)96-67(107)43(10)87-69(109)56(29-47-33-81-37-85-47)93-76(116)59-18-15-23-98(59)63(105)35-84-68(108)51(24-38(2)3)90-70(110)52(25-39(4)5)91-72(112)54(27-45-19-21-48(101)22-20-45)89-62(104)34-83-66(106)42(9)86-75(115)58(36-99)95-73(113)57(30-60(80)102)92-71(111)53(26-40(6)7)94-77(117)65(44(11)100)97-74(114)55(88-61(103)31-79)28-46-32-82-50-17-14-13-16-49(46)50/h13-14,16-17,19-22,32-33,37-44,51-59,64-65,82,99-101H,12,15,18,23-31,34-36,79H2,1-11H3,(H2,80,102)(H,81,85)(H,83,106)(H,84,108)(H,86,115)(H,87,109)(H,88,103)(H,89,104)(H,90,110)(H,91,112)(H,92,111)(H,93,116)(H,94,117)(H,95,113)(H,96,107)(H,97,114)(H,118,119)/t41-,42-,43-,44+,51-,52-,53-,54-,55-,56-,57-,58-,59-,64-,65-/m0/s1
Synonyms:- H-Gly-Trp-Thr-Leu-Asn-Ser-Ala-Gly-Tyr-Leu-Leu-Gly-Pro-His-Ala-Ile-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Galanin (1-16), mouse, porcine, rat
CAS:Galanin (1-16), mouse, porcine, rat is a hippocampal galanin receptor agonist(Kd = 3 nM) with high biological activity on locus coeruleus neurons.Formula:C78H116N20O21Purity:98.65%Color and Shape:White PowderMolecular weight:1669.88Galanin (1-16) (mouse, porcine, rat)
CAS:<p>Please enquire for more information about Galanin (1-16) (mouse, porcine, rat) including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C78H116N20O21Purity:Min. 95%Molecular weight:1,669.88 g/mol

